C14H19F3N2O3S — CID 155853102
(2R,3aS,6aS)-2-methyl-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155853102) has the molecular formula C14H19F3N2O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is (2R,3aS,6aS)-2-methyl-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (2R,3aS,6aS)-2-methyl-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853102 |
| Molecular Formula | C14H19F3N2O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (2R,3aS,6aS)-2-methyl-5-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2C[C@@H]3C[C@@H](C)O[C@@H]3C2)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H18N2OS.C2HF3O2/c1-8-3-10-4-14(6-12(10)15-8)5-11-7-16-9(2)13-11;3-2(4,5)1(6)7/h7-8,10,12H,3-6H2,1-2H3;(H,6,7)/t8-,10+,12-;/m1./s1 |
| InChIKey | VQELVOXAROTZQN-RBJCUBAZSA-N |
| XLogP | 2.69 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |