About 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one
1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one (PubChem CID 155853240) has the molecular formula C18H28F2N2O2
and a molecular weight of 342.43 g/mol. Its IUPAC name is 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one.
Molecular Properties
| Compound Name | 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one |
| PubChem CID | 155853240 |
| Molecular Formula | C18H28F2N2O2 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one |
| SMILES | C=CCCC(=O)N1CCC2(CC1)CC(CN1CCC(F)(F)CC1)O2 |
| InChI | InChI=1S/C18H28F2N2O2/c1-2-3-4-16(23)22-11-5-17(6-12-22)13-15(24-17)14-21-9-7-18(19,20)8-10-21/h2,15H,1,3-14H2 |
| InChIKey | OEYJWLLOHSZXIR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one?
The IUPAC name of 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one (CID 155853240) is 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one.
What is the SMILES notation for 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one?
The canonical SMILES for 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one is C=CCCC(=O)N1CCC2(CC1)CC(CN1CCC(F)(F)CC1)O2.
What is the InChIKey of 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one?
The InChIKey is OEYJWLLOHSZXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28F2N2O2/c1-2-3-4-16(23)22-11-5-17(6-12-22)13-15(24-17)14-21-9-7-18(19,20)8-10-21/h2,15H,1,3-14H2.
What are the key properties of 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one?
1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one has a molecular weight of 342.43 g/mol, XLogP of 2.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(4,4-difluoropiperidin-1-yl)methyl]-1-oxa-7-azaspiro[3.5]nonan-7-yl]pent-4-en-1-one is sourced from PubChem (CID 155853240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).