About 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide
2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide (PubChem CID 15585336) has the molecular formula C8H10ClN3O3
and a molecular weight of 231.64 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide.
Molecular Properties
| Compound Name | 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide |
| PubChem CID | 15585336 |
| Molecular Formula | C8H10ClN3O3 |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide |
| SMILES | COc1ncnc(OC)c1NC(=O)CCl |
| InChI | InChI=1S/C8H10ClN3O3/c1-14-7-6(12-5(13)3-9)8(15-2)11-4-10-7/h4H,3H2,1-2H3,(H,12,13) |
| InChIKey | JNWRIQZKBURPRL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide?
The IUPAC name of 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide (CID 15585336) is 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide.
What is the SMILES notation for 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide?
The canonical SMILES for 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide is COc1ncnc(OC)c1NC(=O)CCl.
What is the InChIKey of 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide?
The InChIKey is JNWRIQZKBURPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O3/c1-14-7-6(12-5(13)3-9)8(15-2)11-4-10-7/h4H,3H2,1-2H3,(H,12,13).
What are the key properties of 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide?
2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide has a molecular weight of 231.64 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(4,6-dimethoxypyrimidin-5-yl)acetamide is sourced from PubChem (CID 15585336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).