C17H28F3NO4 — CID 155853537
6-(cyclopropylmethyl)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155853537) has the molecular formula C17H28F3NO4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(cyclopropylmethyl)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853537 |
| Molecular Formula | C17H28F3NO4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 6-(cyclopropylmethyl)-4a-(ethoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCOCC12CCCOC1CCN(CC1CC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H27NO2.C2HF3O2/c1-2-17-12-15-7-3-9-18-14(15)6-8-16(11-15)10-13-4-5-13;3-2(4,5)1(6)7/h13-14H,2-12H2,1H3;(H,6,7) |
| InChIKey | SEJQUYGDLGQFIV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |