C17H23F3N4O4S — CID 155853973
2-[(3aR,7aR)-4-oxo-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155853973) has the molecular formula C17H23F3N4O4S and a molecular weight of 436.46 g/mol. Its IUPAC name is 2-[(3aR,7aR)-4-oxo-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7aR)-4-oxo-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853973 |
| Molecular Formula | C17H23F3N4O4S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2-[(3aR,7aR)-4-oxo-2-(1,3-thiazol-2-ylmethyl)-1,3,3a,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CN1CC[C@H]2CN(Cc3nccs3)C[C@@H]2C1=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N4O2S.C2HF3O2/c1-17(2)14(20)10-19-5-3-11-7-18(8-12(11)15(19)21)9-13-16-4-6-22-13;3-2(4,5)1(6)7/h4,6,11-12H,3,5,7-10H2,1-2H3;(H,6,7)/t11-,12-;/m0./s1 |
| InChIKey | FHXPVRJZLDAXCY-FXMYHANSSA-N |
| XLogP | 1.14 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |