C19H28F3N5O5 — CID 155854107
1,1-dimethyl-3-[[9-(oxan-4-yl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 155854107) has the molecular formula C19H28F3N5O5 and a molecular weight of 463.46 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[9-(oxan-4-yl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1-dimethyl-3-[[9-(oxan-4-yl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854107 |
| Molecular Formula | C19H28F3N5O5 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 1,1-dimethyl-3-[[9-(oxan-4-yl)-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepin-2-yl]methyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NCc1cc(=O)n2c(n1)CN(C1CCOCC1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5O3.C2HF3O2/c1-20(2)17(24)18-11-13-10-16(23)22-7-3-6-21(12-15(22)19-13)14-4-8-25-9-5-14;3-2(4,5)1(6)7/h10,14H,3-9,11-12H2,1-2H3,(H,18,24);(H,6,7) |
| InChIKey | GOASCWLOLDWXCR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |