C22H28F6N4O6 — CID 155854121
(5aR,9aS)-4-prop-2-enyl-N-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine-8-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155854121) has the molecular formula C22H28F6N4O6 and a molecular weight of 558.48 g/mol. Its IUPAC name is (5aR,9aS)-4-prop-2-enyl-N-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine-8-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (5aR,9aS)-4-prop-2-enyl-N-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine-8-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155854121 |
| Molecular Formula | C22H28F6N4O6 |
| Molecular Weight | 558.48 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (5aR,9aS)-4-prop-2-enyl-N-(pyridin-3-ylmethyl)-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine-8-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1CCO[C@@H]2CN(C(=O)NCc3cccnc3)CC[C@@H]2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4O2.2C2HF3O2/c1-2-7-21-9-10-24-17-14-22(8-5-16(17)13-21)18(23)20-12-15-4-3-6-19-11-15;2*3-2(4,5)1(6)7/h2-4,6,11,16-17H,1,5,7-10,12-14H2,(H,20,23);2*(H,6,7)/t16-,17-;;/m1../s1 |
| InChIKey | ASQHULKDZPMNBT-QAPNYFPESA-N |
| XLogP | 2.77 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.48 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|