C19H27F3N2O3S — CID 155854294
4-[[(3aS,6aS)-2-cyclobutyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155854294) has the molecular formula C19H27F3N2O3S and a molecular weight of 420.50 g/mol. Its IUPAC name is 4-[[(3aS,6aS)-2-cyclobutyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[(3aS,6aS)-2-cyclobutyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854294 |
| Molecular Formula | C19H27F3N2O3S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[[(3aS,6aS)-2-cyclobutyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-3a-yl]methoxymethyl]-2-methyl-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(COC[C@@]23CCC[C@@H]2CN(C2CCC2)C3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2OS.C2HF3O2/c1-13-18-15(10-21-13)9-20-12-17-7-3-4-14(17)8-19(11-17)16-5-2-6-16;3-2(4,5)1(6)7/h10,14,16H,2-9,11-12H2,1H3;(H,6,7)/t14-,17+;/m1./s1 |
| InChIKey | CDHVSUIAMQUCGE-CVLQQERVSA-N |
| XLogP | 4.26 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |