C21H25F6N3O5S — CID 155854943
7-(imidazol-1-ylmethyl)-4-[(5-methylthiophen-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155854943) has the molecular formula C21H25F6N3O5S and a molecular weight of 545.50 g/mol. Its IUPAC name is 7-(imidazol-1-ylmethyl)-4-[(5-methylthiophen-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(imidazol-1-ylmethyl)-4-[(5-methylthiophen-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155854943 |
| Molecular Formula | C21H25F6N3O5S |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | 7-(imidazol-1-ylmethyl)-4-[(5-methylthiophen-2-yl)methyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CCOC3C(Cn4ccnc4)CCC32)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H23N3OS.2C2HF3O2/c1-13-2-4-15(22-13)11-20-8-9-21-17-14(3-5-16(17)20)10-19-7-6-18-12-19;2*3-2(4,5)1(6)7/h2,4,6-7,12,14,16-17H,3,5,8-11H2,1H3;2*(H,6,7) |
| InChIKey | XFBZQNIUVCBZAX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |