C18H25F5N4O3S — CID 155854976
10,10-difluoro-N,N-dimethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155854976) has the molecular formula C18H25F5N4O3S and a molecular weight of 472.48 g/mol. Its IUPAC name is 10,10-difluoro-N,N-dimethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 10,10-difluoro-N,N-dimethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854976 |
| Molecular Formula | C18H25F5N4O3S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 10,10-difluoro-N,N-dimethyl-2-[(2-methyl-1,3-thiazol-4-yl)methyl]-2,7-diazaspiro[4.5]decane-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCC3(C2)CN(C(=O)N(C)C)CCC3(F)F)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H24F2N4OS.C2HF3O2/c1-12-19-13(9-24-12)8-21-6-4-15(10-21)11-22(14(23)20(2)3)7-5-16(15,17)18;3-2(4,5)1(6)7/h9H,4-8,10-11H2,1-3H3;(H,6,7) |
| InChIKey | SHAZZBFAMQKGDS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |