C17H21F3N4O3S2 — CID 155855181
8-(1,3,4-thiadiazol-2-yl)-4-(thiophen-2-ylmethyl)-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid (PubChem CID 155855181) has the molecular formula C17H21F3N4O3S2 and a molecular weight of 450.51 g/mol. Its IUPAC name is 8-(1,3,4-thiadiazol-2-yl)-4-(thiophen-2-ylmethyl)-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid.
| Compound Name | 8-(1,3,4-thiadiazol-2-yl)-4-(thiophen-2-ylmethyl)-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155855181 |
| Molecular Formula | C17H21F3N4O3S2 |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 8-(1,3,4-thiadiazol-2-yl)-4-(thiophen-2-ylmethyl)-1-oxa-4,8-diazaspiro[5.5]undecane;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2CCOC3(CCCN(c4nncs4)C3)C2)c1 |
| InChI | InChI=1S/C15H20N4OS2.C2HF3O2/c1-3-13(21-8-1)9-18-6-7-20-15(10-18)4-2-5-19(11-15)14-17-16-12-22-14;3-2(4,5)1(6)7/h1,3,8,12H,2,4-7,9-11H2;(H,6,7) |
| InChIKey | RSPBGTPAOUEBIR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |