C23H32F6N4O5 — CID 155856049
7-(cyclopropylmethyl)-N,N-dimethyl-2-(propan-2-ylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856049) has the molecular formula C23H32F6N4O5 and a molecular weight of 558.52 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-N,N-dimethyl-2-(propan-2-ylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(cyclopropylmethyl)-N,N-dimethyl-2-(propan-2-ylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856049 |
| Molecular Formula | C23H32F6N4O5 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 7-(cyclopropylmethyl)-N,N-dimethyl-2-(propan-2-ylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)Nc1nc2c(cc1C(=O)N(C)C)CCN(CC1CC1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N4O.2C2HF3O2/c1-13(2)20-18-16(19(24)22(3)4)11-15-7-9-23(12-14-5-6-14)10-8-17(15)21-18;2*3-2(4,5)1(6)7/h11,13-14H,5-10,12H2,1-4H3,(H,20,21);2*(H,6,7) |
| InChIKey | BBTLKMXPXWIPSZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 123.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |