C20H23F6N5O7S — CID 155856119
N-(furan-2-ylmethyl)-8-methyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856119) has the molecular formula C20H23F6N5O7S and a molecular weight of 591.49 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-8-methyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(furan-2-ylmethyl)-8-methyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856119 |
| Molecular Formula | C20H23F6N5O7S |
| Molecular Weight | 591.49 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-8-methyl-2-(5-methyl-1,3,4-thiadiazol-2-yl)-5-oxa-2,8-diazaspiro[3.5]nonane-7-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nnc(N2CC3(C2)CN(C)C(C(=O)NCc2ccco2)CO3)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H21N5O3S.2C2HF3O2/c1-11-18-19-15(25-11)21-9-16(10-21)8-20(2)13(7-24-16)14(22)17-6-12-4-3-5-23-12;2*3-2(4,5)1(6)7/h3-5,13H,6-10H2,1-2H3,(H,17,22);2*(H,6,7) |
| InChIKey | HDJTVXFOTNBLPD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 158.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |