C24H31F7N4O8 — CID 155856129
2-[[4-[(2-fluoro-5-nitrophenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-11-yl]amino]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856129) has the molecular formula C24H31F7N4O8 and a molecular weight of 636.52 g/mol. Its IUPAC name is 2-[[4-[(2-fluoro-5-nitrophenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-11-yl]amino]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[4-[(2-fluoro-5-nitrophenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-11-yl]amino]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856129 |
| Molecular Formula | C24H31F7N4O8 |
| Molecular Weight | 636.52 g/mol |
| Exact Mass | 636.20 |
| IUPAC Name | 2-[[4-[(2-fluoro-5-nitrophenyl)methyl]-1-oxa-4-azaspiro[5.5]undecan-11-yl]amino]-N,N-dimethylacetamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C(=O)CNC1CCCCC12CN(Cc1cc([N+](=O)[O-])ccc1F)CCO2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H29FN4O4.2C2HF3O2/c1-23(2)19(26)12-22-18-5-3-4-8-20(18)14-24(9-10-29-20)13-15-11-16(25(27)28)6-7-17(15)21;2*3-2(4,5)1(6)7/h6-7,11,18,22H,3-5,8-10,12-14H2,1-2H3;2*(H,6,7) |
| InChIKey | OWPQPQXVPBOVSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 162.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|