About (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate
(4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate (PubChem CID 15585620) has the molecular formula C4H15NO8P2
and a molecular weight of 267.11 g/mol. Its IUPAC name is (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate.
Molecular Properties
| Compound Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate |
| PubChem CID | 15585620 |
| Molecular Formula | C4H15NO8P2 |
| Molecular Weight | 267.11 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate |
| SMILES | NCCCC(O)(P(=O)(O)O)P(=O)(O)O.O |
| InChI | InChI=1S/C4H13NO7P2.H2O/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);1H2 |
| InChIKey | AQAZLLYAEFBJMU-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 192.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.11 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate?
The IUPAC name of (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate (CID 15585620) is (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate.
What is the SMILES notation for (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate?
The canonical SMILES for (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate is NCCCC(O)(P(=O)(O)O)P(=O)(O)O.O.
What is the InChIKey of (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate?
The InChIKey is AQAZLLYAEFBJMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H13NO7P2.H2O/c5-3-1-2-4(6,13(7,8)9)14(10,11)12;/h6H,1-3,5H2,(H2,7,8,9)(H2,10,11,12);1H2.
What are the key properties of (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate?
(4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate has a molecular weight of 267.11 g/mol, XLogP of -2.10, 5 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-1-hydroxy-1-phosphonobutyl)phosphonic acid;hydrate is sourced from PubChem (CID 15585620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).