About 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol
1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol (PubChem CID 15585626) has the molecular formula C18H23Cl2N3O2
and a molecular weight of 384.31 g/mol. Its IUPAC name is 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol.
Molecular Properties
| Compound Name | 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol |
| PubChem CID | 15585626 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol |
| SMILES | C=C(c1cc(Cl)cc(Cl)c1OCC(O)CNC(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C18H23Cl2N3O2/c1-12(23-6-5-21-11-23)15-7-13(19)8-16(20)17(15)25-10-14(24)9-22-18(2,3)4/h5-8,11,14,22,24H,1,9-10H2,2-4H3 |
| InChIKey | ICCKDLSKTSZQCC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol?
The IUPAC name of 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol (CID 15585626) is 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol.
What is the SMILES notation for 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol?
The canonical SMILES for 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol is C=C(c1cc(Cl)cc(Cl)c1OCC(O)CNC(C)(C)C)n1ccnc1.
What is the InChIKey of 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol?
The InChIKey is ICCKDLSKTSZQCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23Cl2N3O2/c1-12(23-6-5-21-11-23)15-7-13(19)8-16(20)17(15)25-10-14(24)9-22-18(2,3)4/h5-8,11,14,22,24H,1,9-10H2,2-4H3.
What are the key properties of 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol?
1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol has a molecular weight of 384.31 g/mol, XLogP of 3.84, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(tert-butylamino)-3-[2,4-dichloro-6-(1-imidazol-1-ylethenyl)phenoxy]propan-2-ol is sourced from PubChem (CID 15585626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).