C21H27F8N3O4S — CID 155856705
4-[[9-(cyclopropylmethyl)-6,6-difluoro-2,9-diazaspiro[4.5]decan-2-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856705) has the molecular formula C21H27F8N3O4S and a molecular weight of 569.52 g/mol. Its IUPAC name is 4-[[9-(cyclopropylmethyl)-6,6-difluoro-2,9-diazaspiro[4.5]decan-2-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[9-(cyclopropylmethyl)-6,6-difluoro-2,9-diazaspiro[4.5]decan-2-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856705 |
| Molecular Formula | C21H27F8N3O4S |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | 4-[[9-(cyclopropylmethyl)-6,6-difluoro-2,9-diazaspiro[4.5]decan-2-yl]methyl]-2-methyl-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCC3(C2)CN(CC2CC2)CCC3(F)F)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25F2N3S.2C2HF3O2/c1-13-20-15(10-23-13)9-22-6-4-16(12-22)11-21(8-14-2-3-14)7-5-17(16,18)19;2*3-2(4,5)1(6)7/h10,14H,2-9,11-12H2,1H3;2*(H,6,7) |
| InChIKey | XWIVKXPRBKTPEW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |