C19H25F6N3O4 — CID 155856710
2-[(1-methylpyrrol-2-yl)methyl]-7-prop-2-enyl-2,7-diazaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856710) has the molecular formula C19H25F6N3O4 and a molecular weight of 473.41 g/mol. Its IUPAC name is 2-[(1-methylpyrrol-2-yl)methyl]-7-prop-2-enyl-2,7-diazaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(1-methylpyrrol-2-yl)methyl]-7-prop-2-enyl-2,7-diazaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856710 |
| Molecular Formula | C19H25F6N3O4 |
| Molecular Weight | 473.41 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[(1-methylpyrrol-2-yl)methyl]-7-prop-2-enyl-2,7-diazaspiro[3.4]octane;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1CCC2(C1)CN(Cc1cccn1C)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3.2C2HF3O2/c1-3-7-17-9-6-15(11-17)12-18(13-15)10-14-5-4-8-16(14)2;2*3-2(4,5)1(6)7/h3-5,8H,1,6-7,9-13H2,2H3;2*(H,6,7) |
| InChIKey | AQTKYPMAAUWGMI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|