C20H23F6N3O5S — CID 155856873
7-(imidazol-1-ylmethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155856873) has the molecular formula C20H23F6N3O5S and a molecular weight of 531.48 g/mol. Its IUPAC name is 7-(imidazol-1-ylmethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(imidazol-1-ylmethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155856873 |
| Molecular Formula | C20H23F6N3O5S |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | 7-(imidazol-1-ylmethyl)-4-(thiophen-2-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2CCOC3C(Cn4ccnc4)CCC32)c1 |
| InChI | InChI=1S/C16H21N3OS.2C2HF3O2/c1-2-14(21-9-1)11-19-7-8-20-16-13(3-4-15(16)19)10-18-6-5-17-12-18;2*3-2(4,5)1(6)7/h1-2,5-6,9,12-13,15-16H,3-4,7-8,10-11H2;2*(H,6,7) |
| InChIKey | ODDREERGZFIRIO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |