C19H18F3N5O4S — CID 155856910
[3-(pyridin-2-yloxymethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155856910) has the molecular formula C19H18F3N5O4S and a molecular weight of 469.45 g/mol. Its IUPAC name is [3-(pyridin-2-yloxymethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [3-(pyridin-2-yloxymethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856910 |
| Molecular Formula | C19H18F3N5O4S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [3-(pyridin-2-yloxymethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccsc1)N1CCCn2nnc(COc3ccccn3)c2C1 |
| InChI | InChI=1S/C17H17N5O2S.C2HF3O2/c23-17(13-5-9-25-12-13)21-7-3-8-22-15(10-21)14(19-20-22)11-24-16-4-1-2-6-18-16;3-2(4,5)1(6)7/h1-2,4-6,9,12H,3,7-8,10-11H2;(H,6,7) |
| InChIKey | SMBVQUJBNDOKGN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |