C17H23F3N6O3S — CID 155857578
1,1-dimethyl-3-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 155857578) has the molecular formula C17H23F3N6O3S and a molecular weight of 448.47 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1-dimethyl-3-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857578 |
| Molecular Formula | C17H23F3N6O3S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1,1-dimethyl-3-[[5-(thiophen-3-ylmethyl)-4,6,7,8-tetrahydrotriazolo[1,5-a][1,4]diazepin-3-yl]methyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NCc1nnn2c1CN(Cc1ccsc1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N6OS.C2HF3O2/c1-19(2)15(22)16-8-13-14-10-20(9-12-4-7-23-11-12)5-3-6-21(14)18-17-13;3-2(4,5)1(6)7/h4,7,11H,3,5-6,8-10H2,1-2H3,(H,16,22);(H,6,7) |
| InChIKey | FUQZCQXCXXZYRX-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |