C18H23F3N4O3S — CID 155857634
2-methyl-4-[[1-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid (PubChem CID 155857634) has the molecular formula C18H23F3N4O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is 2-methyl-4-[[1-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-4-[[1-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857634 |
| Molecular Formula | C18H23F3N4O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-methyl-4-[[1-(prop-2-enoxymethyl)-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepin-8-yl]methyl]-1,3-thiazole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOCc1ncn2c1CN(Cc1csc(C)n1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4OS.C2HF3O2/c1-3-7-21-10-15-16-9-19(5-4-6-20(16)12-17-15)8-14-11-22-13(2)18-14;3-2(4,5)1(6)7/h3,11-12H,1,4-10H2,2H3;(H,6,7) |
| InChIKey | RQDYFZXTKBNGSE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|