C18H20F3N5O2S — CID 155857651
3-(pyrrol-1-ylmethyl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine;2,2,2-trifluoroacetic acid (PubChem CID 155857651) has the molecular formula C18H20F3N5O2S and a molecular weight of 427.45 g/mol. Its IUPAC name is 3-(pyrrol-1-ylmethyl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-(pyrrol-1-ylmethyl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857651 |
| Molecular Formula | C18H20F3N5O2S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 3-(pyrrol-1-ylmethyl)-7-(thiophen-2-ylmethyl)-5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]diazepine;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.c1csc(CN2CCc3nnc(Cn4cccc4)n3CC2)c1 |
| InChI | InChI=1S/C16H19N5S.C2HF3O2/c1-2-7-19(6-1)13-16-18-17-15-5-8-20(9-10-21(15)16)12-14-4-3-11-22-14;3-2(4,5)1(6)7/h1-4,6-7,11H,5,8-10,12-13H2;(H,6,7) |
| InChIKey | LTJJCHWGYGRZHU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |