About 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride
4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride (PubChem CID 155858502) has the molecular formula C9H18Cl2N4
and a molecular weight of 253.18 g/mol. Its IUPAC name is 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride.
Molecular Properties
| Compound Name | 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
| PubChem CID | 155858502 |
| Molecular Formula | C9H18Cl2N4 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride |
| SMILES | CCc1nc(C2CCNCC2)n[nH]1.Cl.Cl |
| InChI | InChI=1S/C9H16N4.2ClH/c1-2-8-11-9(13-12-8)7-3-5-10-6-4-7;;/h7,10H,2-6H2,1H3,(H,11,12,13);2*1H |
| InChIKey | DBJOZKBWNLWFPQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The IUPAC name of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride (CID 155858502) is 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride.
What is the SMILES notation for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The canonical SMILES for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride is CCc1nc(C2CCNCC2)n[nH]1.Cl.Cl.
What is the InChIKey of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
The InChIKey is DBJOZKBWNLWFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4.2ClH/c1-2-8-11-9(13-12-8)7-3-5-10-6-4-7;;/h7,10H,2-6H2,1H3,(H,11,12,13);2*1H.
What are the key properties of 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride?
4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride has a molecular weight of 253.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-ethyl-1H-1,2,4-triazol-3-yl)piperidine;dihydrochloride is sourced from PubChem (CID 155858502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).