About 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride
7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride (PubChem CID 155858632) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride.
Molecular Properties
| Compound Name | 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride |
| PubChem CID | 155858632 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride |
| SMILES | CC1(C)CNCC2(CCCC2)O1.Cl |
| InChI | InChI=1S/C10H19NO.ClH/c1-9(2)7-11-8-10(12-9)5-3-4-6-10;/h11H,3-8H2,1-2H3;1H |
| InChIKey | BGHZFNCDEKLMIV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride?
The IUPAC name of 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride (CID 155858632) is 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride.
What is the SMILES notation for 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride?
The canonical SMILES for 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride is CC1(C)CNCC2(CCCC2)O1.Cl.
What is the InChIKey of 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride?
The InChIKey is BGHZFNCDEKLMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO.ClH/c1-9(2)7-11-8-10(12-9)5-3-4-6-10;/h11H,3-8H2,1-2H3;1H.
What are the key properties of 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride?
7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride has a molecular weight of 205.73 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-6-oxa-9-azaspiro[4.5]decane;hydrochloride is sourced from PubChem (CID 155858632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).