About 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride
3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride (PubChem CID 155858641) has the molecular formula C6H7Cl2FN2
and a molecular weight of 197.04 g/mol. Its IUPAC name is 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride |
| PubChem CID | 155858641 |
| Molecular Formula | C6H7Cl2FN2 |
| Molecular Weight | 197.04 g/mol |
| Exact Mass | 196.00 |
| IUPAC Name | 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(F)c(Cl)c1N |
| InChI | InChI=1S/C6H6ClFN2.ClH/c7-5-3(8)1-2-4(9)6(5)10;/h1-2H,9-10H2;1H |
| InChIKey | WEHYIONHUYUAAE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.04 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride?
The IUPAC name of 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride (CID 155858641) is 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride.
What is the SMILES notation for 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride?
The canonical SMILES for 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride is Cl.Nc1ccc(F)c(Cl)c1N.
What is the InChIKey of 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride?
The InChIKey is WEHYIONHUYUAAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClFN2.ClH/c7-5-3(8)1-2-4(9)6(5)10;/h1-2H,9-10H2;1H.
What are the key properties of 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride?
3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride has a molecular weight of 197.04 g/mol, XLogP of 2.07, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-fluorobenzene-1,2-diamine;hydrochloride is sourced from PubChem (CID 155858641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).