methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate

C10H15N3O2 — CID 155858734

IUPACmethyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate
SMILESCOC(=O)CCc1cnc2n1CCNC2
InChIInChI=1S/C10H15N3O2/c1-15-10(14)3-2-8-6-12-9-7-11-4-5-13(8)9/h6,11H,2-5,7H2,1H3
InChIKeyKMVXZDARVISIKA-UHFFFAOYSA-N
MW209.25 g/mol
LogP0.09
Rot. Bonds3

About methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate

methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate (PubChem CID 155858734) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate
PubChem CID155858734
Molecular FormulaC10H15N3O2
Molecular Weight209.25 g/mol
Exact Mass209.12
IUPAC Namemethyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate
SMILESCOC(=O)CCc1cnc2n1CCNC2
InChIInChI=1S/C10H15N3O2/c1-15-10(14)3-2-8-6-12-9-7-11-4-5-13(8)9/h6,11H,2-5,7H2,1H3
InChIKeyKMVXZDARVISIKA-UHFFFAOYSA-N
XLogP0.09
TPSA56.15 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 50.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate?
The IUPAC name of methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate (CID 155858734) is methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate.
What is the SMILES notation for methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate?
The canonical SMILES for methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate is COC(=O)CCc1cnc2n1CCNC2.
What is the InChIKey of methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate?
The InChIKey is KMVXZDARVISIKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-15-10(14)3-2-8-6-12-9-7-11-4-5-13(8)9/h6,11H,2-5,7H2,1H3.
What are the key properties of methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate?
methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate has a molecular weight of 209.25 g/mol, XLogP of 0.09, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyrazin-3-yl)propanoate is sourced from PubChem (CID 155858734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).