About (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride
(1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride (PubChem CID 155858823) has the molecular formula C7H16Cl2N4
and a molecular weight of 227.14 g/mol. Its IUPAC name is (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride |
| PubChem CID | 155858823 |
| Molecular Formula | C7H16Cl2N4 |
| Molecular Weight | 227.14 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride |
| SMILES | CC[C@H](N)c1c(C)nnn1C.Cl.Cl |
| InChI | InChI=1S/C7H14N4.2ClH/c1-4-6(8)7-5(2)9-10-11(7)3;;/h6H,4,8H2,1-3H3;2*1H/t6-;;/m0../s1 |
| InChIKey | RSLYXFQAPVJOEK-ILKKLZGPSA-N |
| XLogP | 1.38 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride?
The IUPAC name of (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride (CID 155858823) is (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride.
What is the SMILES notation for (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride?
The canonical SMILES for (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride is CC[C@H](N)c1c(C)nnn1C.Cl.Cl.
What is the InChIKey of (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride?
The InChIKey is RSLYXFQAPVJOEK-ILKKLZGPSA-N. The full InChI is InChI=1S/C7H14N4.2ClH/c1-4-6(8)7-5(2)9-10-11(7)3;;/h6H,4,8H2,1-3H3;2*1H/t6-;;/m0../s1.
What are the key properties of (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride?
(1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride has a molecular weight of 227.14 g/mol, XLogP of 1.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(3,5-dimethyltriazol-4-yl)propan-1-amine;dihydrochloride is sourced from PubChem (CID 155858823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).