C16H33BO3Si — CID 155858826
tert-butyl-dimethyl-[[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxy]silane (PubChem CID 155858826) has the molecular formula C16H33BO3Si and a molecular weight of 312.34 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxy]silane |
|---|---|
| PubChem CID | 155858826 |
| Molecular Formula | C16H33BO3Si |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]methoxy]silane |
| SMILES | CC1(C)OB([C@@H]2C[C@H]2CO[Si](C)(C)C(C)(C)C)OC1(C)C |
| InChI | InChI=1S/C16H33BO3Si/c1-14(2,3)21(8,9)18-11-12-10-13(12)17-19-15(4,5)16(6,7)20-17/h12-13H,10-11H2,1-9H3/t12-,13+/m0/s1 |
| InChIKey | VPYJHKWXPHLMSE-QWHCGFSZSA-N |
| XLogP | 4.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|