C15H21BN2O2 — CID 155858898
6,7-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine (PubChem CID 155858898) has the molecular formula C15H21BN2O2 and a molecular weight of 272.16 g/mol. Its IUPAC name is 6,7-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine.
| Compound Name | 6,7-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 155858898 |
| Molecular Formula | C15H21BN2O2 |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 6,7-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]pyridine |
| SMILES | Cc1ccc2c(B3OC(C)(C)C(C)(C)O3)cnn2c1C |
| InChI | InChI=1S/C15H21BN2O2/c1-10-7-8-13-12(9-17-18(13)11(10)2)16-19-14(3,4)15(5,6)20-16/h7-9H,1-6H3 |
| InChIKey | YEQXOGODWGTOEB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|