C20H30BNO4 — CID 155858935
tert-butyl (2S)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate (PubChem CID 155858935) has the molecular formula C20H30BNO4 and a molecular weight of 359.28 g/mol. Its IUPAC name is tert-butyl (2S)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 155858935 |
| Molecular Formula | C20H30BNO4 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | tert-butyl (2S)-2-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
| SMILES | C[C@H]1Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H30BNO4/c1-13-11-14-12-15(21-25-19(5,6)20(7,8)26-21)9-10-16(14)22(13)17(23)24-18(2,3)4/h9-10,12-13H,11H2,1-8H3/t13-/m0/s1 |
| InChIKey | OTBRHFQIDNRETG-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|