C14H27BClNO2 — CID 155859006
4-[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]piperidine;hydrochloride (PubChem CID 155859006) has the molecular formula C14H27BClNO2 and a molecular weight of 287.64 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]piperidine;hydrochloride.
| Compound Name | 4-[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 155859006 |
| Molecular Formula | C14H27BClNO2 |
| Molecular Weight | 287.64 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 4-[(1R,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]piperidine;hydrochloride |
| SMILES | CC1(C)OB([C@@H]2C[C@H]2C2CCNCC2)OC1(C)C.Cl |
| InChI | InChI=1S/C14H26BNO2.ClH/c1-13(2)14(3,4)18-15(17-13)12-9-11(12)10-5-7-16-8-6-10;/h10-12,16H,5-9H2,1-4H3;1H/t11-,12+;/m0./s1 |
| InChIKey | QUIJVEXIOWDVAA-ZVWHLABXSA-N |
| XLogP | 2.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|