C17H23F3N2O5 — CID 155859334
[(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155859334) has the molecular formula C17H23F3N2O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is [(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155859334 |
| Molecular Formula | C17H23F3N2O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | [(3R,3aS,6aS)-3-[(dimethylamino)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(3-methylfuran-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccoc1C(=O)N1C[C@@H]2[C@H](CN(C)C)CO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O3.C2HF3O2/c1-10-4-5-19-14(10)15(18)17-7-12-11(6-16(2)3)9-20-13(12)8-17;3-2(4,5)1(6)7/h4-5,11-13H,6-9H2,1-3H3;(H,6,7)/t11-,12-,13-;/m1./s1 |
| InChIKey | TWZNJDZUSQAIMT-NLPVPVDASA-N |
| XLogP | 1.87 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |