C18H23F6N5O4S — CID 155859928
N,N-dimethyl-1-[8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155859928) has the molecular formula C18H23F6N5O4S and a molecular weight of 519.47 g/mol. Its IUPAC name is N,N-dimethyl-1-[8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-1-[8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155859928 |
| Molecular Formula | C18H23F6N5O4S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | N,N-dimethyl-1-[8-(1,3-thiazol-2-ylmethyl)-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-6-yl]methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CC1CN(Cc2nccs2)Cc2nccn2C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H21N5S.2C2HF3O2/c1-17(2)7-12-8-18(11-14-16-4-6-20-14)10-13-15-3-5-19(13)9-12;2*3-2(4,5)1(6)7/h3-6,12H,7-11H2,1-2H3;2*(H,6,7) |
| InChIKey | BMEIUOHQRMQVGM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |