C22H30F3N5O4S2 — CID 155860597
2-methyl-1'-[(3-methylthiophen-2-yl)methyl]-1,1-dioxo-N-propan-2-ylspiro[3H-pyrimido[4,5-e]thiazine-4,4'-piperidine]-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 155860597) has the molecular formula C22H30F3N5O4S2 and a molecular weight of 549.64 g/mol. Its IUPAC name is 2-methyl-1'-[(3-methylthiophen-2-yl)methyl]-1,1-dioxo-N-propan-2-ylspiro[3H-pyrimido[4,5-e]thiazine-4,4'-piperidine]-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methyl-1'-[(3-methylthiophen-2-yl)methyl]-1,1-dioxo-N-propan-2-ylspiro[3H-pyrimido[4,5-e]thiazine-4,4'-piperidine]-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155860597 |
| Molecular Formula | C22H30F3N5O4S2 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | 2-methyl-1'-[(3-methylthiophen-2-yl)methyl]-1,1-dioxo-N-propan-2-ylspiro[3H-pyrimido[4,5-e]thiazine-4,4'-piperidine]-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccsc1CN1CCC2(CC1)CN(C)S(=O)(=O)c1cnc(NC(C)C)nc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H29N5O2S2.C2HF3O2/c1-14(2)22-19-21-11-17-18(23-19)20(13-24(4)29(17,26)27)6-8-25(9-7-20)12-16-15(3)5-10-28-16;3-2(4,5)1(6)7/h5,10-11,14H,6-9,12-13H2,1-4H3,(H,21,22,23);(H,6,7) |
| InChIKey | RFTZMGRPCNEPRF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |