C19H23F3N4O4S — CID 155860920
(1S,3aR,7aR)-5-(6-methoxypyrimidin-4-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155860920) has the molecular formula C19H23F3N4O4S and a molecular weight of 460.48 g/mol. Its IUPAC name is (1S,3aR,7aR)-5-(6-methoxypyrimidin-4-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,3aR,7aR)-5-(6-methoxypyrimidin-4-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155860920 |
| Molecular Formula | C19H23F3N4O4S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | (1S,3aR,7aR)-5-(6-methoxypyrimidin-4-yl)-1-[(4-methyl-1,3-thiazol-2-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(N2CC[C@@H]3[C@@H](CO[C@H]3Cc3nc(C)cs3)C2)ncn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N4O2S.C2HF3O2/c1-11-9-24-17(20-11)5-14-13-3-4-21(7-12(13)8-23-14)15-6-16(22-2)19-10-18-15;3-2(4,5)1(6)7/h6,9-10,12-14H,3-5,7-8H2,1-2H3;(H,6,7)/t12-,13-,14+;/m1./s1 |
| InChIKey | BJSDSDXUCDAQBY-NNNATCHMSA-N |
| XLogP | 2.97 |
| TPSA | 97.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |