C21H25F3N4O4 — CID 155861005
11-[(4-methylphenyl)methyl]-4-propan-2-yl-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid (PubChem CID 155861005) has the molecular formula C21H25F3N4O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 11-[(4-methylphenyl)methyl]-4-propan-2-yl-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 11-[(4-methylphenyl)methyl]-4-propan-2-yl-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861005 |
| Molecular Formula | C21H25F3N4O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 11-[(4-methylphenyl)methyl]-4-propan-2-yl-4,8,11,12-tetrazatricyclo[6.4.0.02,6]dodec-1(12)-ene-9,10-dione;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(Cn2nc3n(c(=O)c2=O)CC2CN(C(C)C)CC32)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N4O2.C2HF3O2/c1-12(2)21-9-15-10-22-17(16(15)11-21)20-23(19(25)18(22)24)8-14-6-4-13(3)5-7-14;3-2(4,5)1(6)7/h4-7,12,15-16H,8-11H2,1-3H3;(H,6,7) |
| InChIKey | JNMMOXGNLZDDTJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|