C20H29F3N6O4 — CID 155861049
2-[7-[(2,5-dimethylpyrazol-3-yl)methyl]-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid (PubChem CID 155861049) has the molecular formula C20H29F3N6O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is 2-[7-[(2,5-dimethylpyrazol-3-yl)methyl]-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[7-[(2,5-dimethylpyrazol-3-yl)methyl]-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861049 |
| Molecular Formula | C20H29F3N6O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2-[7-[(2,5-dimethylpyrazol-3-yl)methyl]-8-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-2-yl]-N-(2-methoxyethyl)acetamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)Cc1cn2c(n1)C(C)N(Cc1cc(C)nn1C)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N6O2.C2HF3O2/c1-13-9-16(22(3)21-13)12-23-6-7-24-11-15(20-18(24)14(23)2)10-17(25)19-5-8-26-4;3-2(4,5)1(6)7/h9,11,14H,5-8,10,12H2,1-4H3,(H,19,25);(H,6,7) |
| InChIKey | QPFWDBKGSAFMLN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 114.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|