C22H21F6N5O6S2 — CID 155861057
N-[2-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydroquinazolin-6-yl]thiophene-2-sulfonamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155861057) has the molecular formula C22H21F6N5O6S2 and a molecular weight of 629.56 g/mol. Its IUPAC name is N-[2-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydroquinazolin-6-yl]thiophene-2-sulfonamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[2-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydroquinazolin-6-yl]thiophene-2-sulfonamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155861057 |
| Molecular Formula | C22H21F6N5O6S2 |
| Molecular Weight | 629.56 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | N-[2-(pyridin-3-ylmethylamino)-5,6,7,8-tetrahydroquinazolin-6-yl]thiophene-2-sulfonamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=S(=O)(NC1CCc2nc(NCc3cccnc3)ncc2C1)c1cccs1 |
| InChI | InChI=1S/C18H19N5O2S2.2C2HF3O2/c24-27(25,17-4-2-8-26-17)23-15-5-6-16-14(9-15)12-21-18(22-16)20-11-13-3-1-7-19-10-13;2*3-2(4,5)1(6)7/h1-4,7-8,10,12,15,23H,5-6,9,11H2,(H,20,21,22);2*(H,6,7) |
| InChIKey | ORZPZAPJNCKACA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |