C20H27F6N3O5S — CID 155861252
2-[[(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155861252) has the molecular formula C20H27F6N3O5S and a molecular weight of 535.51 g/mol. Its IUPAC name is 2-[[(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[[(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155861252 |
| Molecular Formula | C20H27F6N3O5S |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 2-[[(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2CC[C@H]3[C@H]2CCN3CC2CCOCC2)n1 |
| InChI | InChI=1S/C16H25N3OS.2C2HF3O2/c1-6-18(11-13-3-8-20-9-4-13)14-2-7-19(15(1)14)12-16-17-5-10-21-16;2*3-2(4,5)1(6)7/h5,10,13-15H,1-4,6-9,11-12H2;2*(H,6,7)/t14-,15+;;/m0../s1 |
| InChIKey | VUHJVQXWRMTNPD-FZMMWMHASA-N |
| XLogP | 3.48 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |