C20H32F3NO5 — CID 155861319
6-(oxan-4-ylmethyl)-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155861319) has the molecular formula C20H32F3NO5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 6-(oxan-4-ylmethyl)-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 6-(oxan-4-ylmethyl)-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861319 |
| Molecular Formula | C20H32F3NO5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 6-(oxan-4-ylmethyl)-4a-(prop-2-enoxymethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | C=CCOCC12CCCOC1CCN(CC1CCOCC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H31NO3.C2HF3O2/c1-2-9-21-15-18-7-3-10-22-17(18)4-8-19(14-18)13-16-5-11-20-12-6-16;3-2(4,5)1(6)7/h2,16-17H,1,3-15H2;(H,6,7) |
| InChIKey | YKDXWZVWFYBRNV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|