C22H19F3N4O4S2 — CID 155861615
[1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[2H-pyrrolo[3,2-b]pyridine-3,3'-pyrrolidine]-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155861615) has the molecular formula C22H19F3N4O4S2 and a molecular weight of 524.55 g/mol. Its IUPAC name is [1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[2H-pyrrolo[3,2-b]pyridine-3,3'-pyrrolidine]-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[2H-pyrrolo[3,2-b]pyridine-3,3'-pyrrolidine]-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155861615 |
| Molecular Formula | C22H19F3N4O4S2 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | [1'-(2-methyl-1,3-thiazole-4-carbonyl)spiro[2H-pyrrolo[3,2-b]pyridine-3,3'-pyrrolidine]-1-yl]-thiophen-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(C(=O)N2CCC3(C2)CN(C(=O)c2ccsc2)c2cccnc23)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H18N4O2S2.C2HF3O2/c1-13-22-15(10-28-13)19(26)23-7-5-20(11-23)12-24(16-3-2-6-21-17(16)20)18(25)14-4-8-27-9-14;3-2(4,5)1(6)7/h2-4,6,8-10H,5,7,11-12H2,1H3;(H,6,7) |
| InChIKey | BSUAIOLNRAOWRD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |