About N-(5-chloro-2,1-benzothiazol-3-yl)butanamide
N-(5-chloro-2,1-benzothiazol-3-yl)butanamide (PubChem CID 15586291) has the molecular formula C11H11ClN2OS
and a molecular weight of 254.74 g/mol. Its IUPAC name is N-(5-chloro-2,1-benzothiazol-3-yl)butanamide.
Molecular Properties
| Compound Name | N-(5-chloro-2,1-benzothiazol-3-yl)butanamide |
| PubChem CID | 15586291 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | N-(5-chloro-2,1-benzothiazol-3-yl)butanamide |
| SMILES | CCCC(=O)Nc1snc2ccc(Cl)cc12 |
| InChI | InChI=1S/C11H11ClN2OS/c1-2-3-10(15)13-11-8-6-7(12)4-5-9(8)14-16-11/h4-6H,2-3H2,1H3,(H,13,15) |
| InChIKey | URKYUWSABNJWHT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5-chloro-2,1-benzothiazol-3-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-2,1-benzothiazol-3-yl)butanamide?
The IUPAC name of N-(5-chloro-2,1-benzothiazol-3-yl)butanamide (CID 15586291) is N-(5-chloro-2,1-benzothiazol-3-yl)butanamide.
What is the SMILES notation for N-(5-chloro-2,1-benzothiazol-3-yl)butanamide?
The canonical SMILES for N-(5-chloro-2,1-benzothiazol-3-yl)butanamide is CCCC(=O)Nc1snc2ccc(Cl)cc12.
What is the InChIKey of N-(5-chloro-2,1-benzothiazol-3-yl)butanamide?
The InChIKey is URKYUWSABNJWHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2OS/c1-2-3-10(15)13-11-8-6-7(12)4-5-9(8)14-16-11/h4-6H,2-3H2,1H3,(H,13,15).
What are the key properties of N-(5-chloro-2,1-benzothiazol-3-yl)butanamide?
N-(5-chloro-2,1-benzothiazol-3-yl)butanamide has a molecular weight of 254.74 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-2,1-benzothiazol-3-yl)butanamide is sourced from PubChem (CID 15586291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).