C20H19F6N5O5S — CID 155863175
1-(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(thiophen-3-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863175) has the molecular formula C20H19F6N5O5S and a molecular weight of 555.46 g/mol. Its IUPAC name is 1-(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(thiophen-3-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(thiophen-3-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863175 |
| Molecular Formula | C20H19F6N5O5S |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.10 |
| IUPAC Name | 1-(3-pyridin-4-yl-6,7-dihydro-4H-triazolo[5,1-c][1,4]oxazin-6-yl)-N-(thiophen-3-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1cc(-c2nnn3c2COC(CNCc2ccsc2)C3)ccn1 |
| InChI | InChI=1S/C16H17N5OS.2C2HF3O2/c1-4-17-5-2-13(1)16-15-10-22-14(9-21(15)20-19-16)8-18-7-12-3-6-23-11-12;2*3-2(4,5)1(6)7/h1-6,11,14,18H,7-10H2;2*(H,6,7) |
| InChIKey | CFYUBRYMBLMNLM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 139.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |