C18H27ClN2 — CID 15586322
1-(4-chlorophenyl)-1-N,1-N,4-N-trimethyl-4-N-prop-2-enylcyclohexane-1,4-diamine (PubChem CID 15586322) has the molecular formula C18H27ClN2 and a molecular weight of 306.88 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-1-N,1-N,4-N-trimethyl-4-N-prop-2-enylcyclohexane-1,4-diamine.
| Compound Name | 1-(4-chlorophenyl)-1-N,1-N,4-N-trimethyl-4-N-prop-2-enylcyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 15586322 |
| Molecular Formula | C18H27ClN2 |
| Molecular Weight | 306.88 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-(4-chlorophenyl)-1-N,1-N,4-N-trimethyl-4-N-prop-2-enylcyclohexane-1,4-diamine |
| SMILES | C=CCN(C)C1CCC(c2ccc(Cl)cc2)(N(C)C)CC1 |
| InChI | InChI=1S/C18H27ClN2/c1-5-14-21(4)17-10-12-18(13-11-17,20(2)3)15-6-8-16(19)9-7-15/h5-9,17H,1,10-14H2,2-4H3 |
| InChIKey | HNKUKJDTKAJKBH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|