C21H28F6N2O6S — CID 155863259
4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155863259) has the molecular formula C21H28F6N2O6S and a molecular weight of 550.52 g/mol. Its IUPAC name is 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155863259 |
| Molecular Formula | C21H28F6N2O6S |
| Molecular Weight | 550.52 g/mol |
| Exact Mass | 550.16 |
| IUPAC Name | 4a-(cyclopropylmethoxymethyl)-6-(1,3-thiazol-2-ylmethyl)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1csc(CN2CCC3OCCCC3(COCC3CC3)C2)n1 |
| InChI | InChI=1S/C17H26N2O2S.2C2HF3O2/c1-5-17(13-20-11-14-2-3-14)12-19(7-4-15(17)21-8-1)10-16-18-6-9-22-16;2*3-2(4,5)1(6)7/h6,9,14-15H,1-5,7-8,10-13H2;2*(H,6,7) |
| InChIKey | HCSOQCAMTOWOCH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |