C11H13N3O — CID 15586385
2,5-dimethyl-6-phenyl-4,5-dihydro-1,2,4-triazin-3-one (PubChem CID 15586385) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2,5-dimethyl-6-phenyl-4,5-dihydro-1,2,4-triazin-3-one.
| Compound Name | 2,5-dimethyl-6-phenyl-4,5-dihydro-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 15586385 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2,5-dimethyl-6-phenyl-4,5-dihydro-1,2,4-triazin-3-one |
| SMILES | CC1NC(=O)N(C)N=C1c1ccccc1 |
| InChI | InChI=1S/C11H13N3O/c1-8-10(9-6-4-3-5-7-9)13-14(2)11(15)12-8/h3-8H,1-2H3,(H,12,15) |
| InChIKey | UKXZLIHBIJGSGC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |