C21H26F6N4O5 — CID 155864196
(3aS,7aS)-2-(furan-3-ylmethyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155864196) has the molecular formula C21H26F6N4O5 and a molecular weight of 528.45 g/mol. Its IUPAC name is (3aS,7aS)-2-(furan-3-ylmethyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aS,7aS)-2-(furan-3-ylmethyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155864196 |
| Molecular Formula | C21H26F6N4O5 |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (3aS,7aS)-2-(furan-3-ylmethyl)-5-[(1-methylpyrazol-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cn1cc(CN2CC[C@@H]3CN(Cc4ccoc4)C[C@@H]3C2)cn1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O.2C2HF3O2/c1-19-7-15(6-18-19)9-20-4-2-16-10-21(12-17(16)11-20)8-14-3-5-22-13-14;2*3-2(4,5)1(6)7/h3,5-7,13,16-17H,2,4,8-12H2,1H3;2*(H,6,7)/t16-,17+;;/m1../s1 |
| InChIKey | PDNMEUXBISRKKF-LWPKXAGOSA-N |
| XLogP | 3.23 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |