C18H24N4O2 — CID 155864288
(2S,3aS,6aS)-2-(3-methyl-1H-1,2,4-triazol-5-yl)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole (PubChem CID 155864288) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S,3aS,6aS)-2-(3-methyl-1H-1,2,4-triazol-5-yl)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole.
| Compound Name | (2S,3aS,6aS)-2-(3-methyl-1H-1,2,4-triazol-5-yl)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
|---|---|
| PubChem CID | 155864288 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S,3aS,6aS)-2-(3-methyl-1H-1,2,4-triazol-5-yl)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrole |
| SMILES | Cc1n[nH]c([C@@H]2C[C@H]3CN(CCOCc4ccccc4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C18H24N4O2/c1-13-19-18(21-20-13)16-9-15-10-22(11-17(15)24-16)7-8-23-12-14-5-3-2-4-6-14/h2-6,15-17H,7-12H2,1H3,(H,19,20,21)/t15-,16-,17+/m0/s1 |
| InChIKey | YCQHLUWEIIWDAA-YESZJQIVSA-N |
| XLogP | 2.09 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|