C22H28F6N4O4S2 — CID 155864417
2-methyl-4-[[3-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155864417) has the molecular formula C22H28F6N4O4S2 and a molecular weight of 590.61 g/mol. Its IUPAC name is 2-methyl-4-[[3-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-methyl-4-[[3-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155864417 |
| Molecular Formula | C22H28F6N4O4S2 |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 2-methyl-4-[[3-(1,3-thiazol-2-ylmethyl)-3,9-diazaspiro[5.5]undecan-9-yl]methyl]-1,3-thiazole;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCC3(CC2)CCN(Cc2nccs2)CC3)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N4S2.2C2HF3O2/c1-15-20-16(14-24-15)12-21-7-2-18(3-8-21)4-9-22(10-5-18)13-17-19-6-11-23-17;2*3-2(4,5)1(6)7/h6,11,14H,2-5,7-10,12-13H2,1H3;2*(H,6,7) |
| InChIKey | SRTXQRLTWZIRRZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |